C24H25FN2O4S2 — CID 30278169
2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 30278169) has the molecular formula C24H25FN2O4S2 and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30278169 |
| Molecular Formula | C24H25FN2O4S2 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSc2ccccc2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H25FN2O4S2/c1-31-19-12-14-21(15-13-19)33(29,30)27(23-11-6-5-10-22(23)25)18-24(28)26-16-7-17-32-20-8-3-2-4-9-20/h2-6,8-15H,7,16-18H2,1H3,(H,26,28) |
| InChIKey | XVCPJSVWRILZDL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|