C27H32N2O5S2 — CID 30215375
2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide (PubChem CID 30215375) has the molecular formula C27H32N2O5S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide.
| Compound Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 30215375 |
| Molecular Formula | C27H32N2O5S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCCSc2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C27H32N2O5S2/c1-20-6-11-23(12-7-20)35-17-5-16-28-27(30)19-29(25-18-22(33-3)10-15-26(25)34-4)36(31,32)24-13-8-21(2)9-14-24/h6-15,18H,5,16-17,19H2,1-4H3,(H,28,30) |
| InChIKey | WFXYAARYSVBLHR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|