C26H30N2O6S — CID 30215340
2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 30215340) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 30215340 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCOc2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C26H30N2O6S/c1-19-5-9-21(10-6-19)34-16-15-27-26(29)18-28(24-17-22(32-3)11-14-25(24)33-4)35(30,31)23-12-7-20(2)8-13-23/h5-14,17H,15-16,18H2,1-4H3,(H,27,29) |
| InChIKey | HWVNWLONHVNEHK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|