C28H34N2O6S — CID 30215393
2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide (PubChem CID 30215393) has the molecular formula C28H34N2O6S and a molecular weight of 526.66 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide.
| Compound Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30215393 |
| Molecular Formula | C28H34N2O6S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
| SMILES | CCOc1ccc(CCCNC(=O)CN(c2cc(OC)ccc2OC)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H34N2O6S/c1-5-36-23-12-10-22(11-13-23)7-6-18-29-28(31)20-30(26-19-24(34-3)14-17-27(26)35-4)37(32,33)25-15-8-21(2)9-16-25/h8-17,19H,5-7,18,20H2,1-4H3,(H,29,31) |
| InChIKey | LIZKPLCISXGIRO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|