C28H34N2O4S — CID 30212800
2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide (PubChem CID 30212800) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide.
| Compound Name | 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30212800 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-ethoxyphenyl)propyl]acetamide |
| SMILES | CCOc1ccc(CCCNC(=O)CN(c2ccc(C)c(C)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H34N2O4S/c1-5-34-26-14-11-24(12-15-26)7-6-18-29-28(31)20-30(25-13-10-22(3)23(4)19-25)35(32,33)27-16-8-21(2)9-17-27/h8-17,19H,5-7,18,20H2,1-4H3,(H,29,31) |
| InChIKey | QWRUVTHVIWVQGC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|