C27H31ClN2O4S — CID 30214045
2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide (PubChem CID 30214045) has the molecular formula C27H31ClN2O4S and a molecular weight of 515.08 g/mol. Its IUPAC name is 2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide.
| Compound Name | 2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30214045 |
| Molecular Formula | C27H31ClN2O4S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccc(OC(C)C)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H31ClN2O4S/c1-20(2)34-25-14-8-22(9-15-25)5-4-18-29-27(31)19-30(24-12-10-23(28)11-13-24)35(32,33)26-16-6-21(3)7-17-26/h6-17,20H,4-5,18-19H2,1-3H3,(H,29,31) |
| InChIKey | NVTRMNNUODJKFF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|