C28H34N2O4S — CID 30210904
2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide (PubChem CID 30210904) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide.
| Compound Name | 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30210904 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(4-propan-2-yloxyphenyl)propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccc(OC(C)C)cc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C28H34N2O4S/c1-21(2)34-25-15-13-24(14-16-25)9-7-19-29-28(31)20-30(27-10-6-5-8-23(27)4)35(32,33)26-17-11-22(3)12-18-26/h5-6,8,10-18,21H,7,9,19-20H2,1-4H3,(H,29,31) |
| InChIKey | SQIZLKSVOQIMNA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|