C24H24ClFN2O3S — CID 30251563
2-(N-(4-chlorophenyl)sulfonyl-4-methylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 30251563) has the molecular formula C24H24ClFN2O3S and a molecular weight of 474.99 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-4-methylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-4-methylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30251563 |
| Molecular Formula | C24H24ClFN2O3S |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-4-methylanilino)-N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCCCc2ccc(F)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H24ClFN2O3S/c1-18-4-12-22(13-5-18)28(32(30,31)23-14-8-20(25)9-15-23)17-24(29)27-16-2-3-19-6-10-21(26)11-7-19/h4-15H,2-3,16-17H2,1H3,(H,27,29) |
| InChIKey | HHGVFFJCCCCOSL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|