C20H25FN2O4S — CID 126152032
N-(3-ethoxypropyl)-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126152032) has the molecular formula C20H25FN2O4S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126152032 |
| Molecular Formula | C20H25FN2O4S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(3-ethoxypropyl)-2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOCCCNC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25FN2O4S/c1-3-27-14-4-13-22-20(24)15-23(18-9-7-17(21)8-10-18)28(25,26)19-11-5-16(2)6-12-19/h5-12H,3-4,13-15H2,1-2H3,(H,22,24) |
| InChIKey | RPWSPEDSCUWFRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|