C24H25FN2O3S2 — CID 30205702
2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide (PubChem CID 30205702) has the molecular formula C24H25FN2O3S2 and a molecular weight of 472.61 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 30205702 |
| Molecular Formula | C24H25FN2O3S2 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[3-(4-methylphenyl)sulfanylpropyl]acetamide |
| SMILES | Cc1ccc(SCCCNC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25FN2O3S2/c1-19-8-14-22(15-9-19)31-17-5-16-26-24(28)18-27(21-12-10-20(25)11-13-21)32(29,30)23-6-3-2-4-7-23/h2-4,6-15H,5,16-18H2,1H3,(H,26,28) |
| InChIKey | GQSTYFGCHHCCEW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|