C25H26BrClN2O4S — CID 43896909
2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(4-chlorophenyl)propyl]acetamide (PubChem CID 43896909) has the molecular formula C25H26BrClN2O4S and a molecular weight of 565.92 g/mol. Its IUPAC name is 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(4-chlorophenyl)propyl]acetamide.
| Compound Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(4-chlorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43896909 |
| Molecular Formula | C25H26BrClN2O4S |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(4-chlorophenyl)propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccc(Cl)cc2)c2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C25H26BrClN2O4S/c1-18-5-11-21(12-6-18)29(34(31,32)22-13-14-24(33-2)23(26)16-22)17-25(30)28-15-3-4-19-7-9-20(27)10-8-19/h5-14,16H,3-4,15,17H2,1-2H3,(H,28,30) |
| InChIKey | OVYIAANRHPYLJB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|