C25H28BrN3O4S — CID 53279100
2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 53279100) has the molecular formula C25H28BrN3O4S and a molecular weight of 546.49 g/mol. Its IUPAC name is 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 53279100 |
| Molecular Formula | C25H28BrN3O4S |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(N(C)C)cc2)c2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C25H28BrN3O4S/c1-18-5-9-21(10-6-18)29(34(31,32)22-13-14-24(33-4)23(26)15-22)17-25(30)27-16-19-7-11-20(12-8-19)28(2)3/h5-15H,16-17H2,1-4H3,(H,27,30) |
| InChIKey | ZHZRLSBKNRVGQF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|