C26H29BrN2O5S — CID 43896911
2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(2-methoxyphenyl)propyl]acetamide (PubChem CID 43896911) has the molecular formula C26H29BrN2O5S and a molecular weight of 561.50 g/mol. Its IUPAC name is 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(2-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(2-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43896911 |
| Molecular Formula | C26H29BrN2O5S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[3-(2-methoxyphenyl)propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccccc2OC)c2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C26H29BrN2O5S/c1-19-10-12-21(13-11-19)29(35(31,32)22-14-15-25(34-3)23(27)17-22)18-26(30)28-16-6-8-20-7-4-5-9-24(20)33-2/h4-5,7,9-15,17H,6,8,16,18H2,1-3H3,(H,28,30) |
| InChIKey | QEUFWLVXBUNIRR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|