C27H30BrN3O5S — CID 126274705
2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]amino]-N-butylbenzamide (PubChem CID 126274705) has the molecular formula C27H30BrN3O5S and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]amino]-N-butylbenzamide.
| Compound Name | 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 126274705 |
| Molecular Formula | C27H30BrN3O5S |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | 2-[[2-(N-(3-bromo-4-methoxyphenyl)sulfonyl-4-methylanilino)acetyl]amino]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C27H30BrN3O5S/c1-4-5-16-29-27(33)22-8-6-7-9-24(22)30-26(32)18-31(20-12-10-19(2)11-13-20)37(34,35)21-14-15-25(36-3)23(28)17-21/h6-15,17H,4-5,16,18H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | VHTYEMZUDLVECG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|