C28H30F3N3O6S — CID 43900138
N-butyl-2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzamide (PubChem CID 43900138) has the molecular formula C28H30F3N3O6S and a molecular weight of 593.62 g/mol. Its IUPAC name is N-butyl-2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-butyl-2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 43900138 |
| Molecular Formula | C28H30F3N3O6S |
| Molecular Weight | 593.62 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | N-butyl-2-[[2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30F3N3O6S/c1-4-5-15-32-27(36)22-11-6-7-12-23(22)33-26(35)18-34(20-10-8-9-19(16-20)28(29,30)31)41(37,38)21-13-14-24(39-2)25(17-21)40-3/h6-14,16-17H,4-5,15,18H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | UGJRWSFISZAXBZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|