C26H26ClF3N2O5S — CID 43901074
N-[3-(4-chlorophenyl)propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 43901074) has the molecular formula C26H26ClF3N2O5S and a molecular weight of 571.02 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 43901074 |
| Molecular Formula | C26H26ClF3N2O5S |
| Molecular Weight | 571.02 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCc2ccc(Cl)cc2)c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C26H26ClF3N2O5S/c1-36-23-13-12-22(16-24(23)37-2)38(34,35)32(21-7-3-6-19(15-21)26(28,29)30)17-25(33)31-14-4-5-18-8-10-20(27)11-9-18/h3,6-13,15-16H,4-5,14,17H2,1-2H3,(H,31,33) |
| InChIKey | BHZFRAADWRKYQW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.02 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|