C24H22F4N2O3S — CID 30204334
2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-(4-fluorophenyl)propyl]acetamide (PubChem CID 30204334) has the molecular formula C24H22F4N2O3S and a molecular weight of 494.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-(4-fluorophenyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-(4-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30204334 |
| Molecular Formula | C24H22F4N2O3S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[3-(4-fluorophenyl)propyl]acetamide |
| SMILES | O=C(CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H22F4N2O3S/c25-20-13-11-18(12-14-20)6-5-15-29-23(31)17-30(34(32,33)22-9-2-1-3-10-22)21-8-4-7-19(16-21)24(26,27)28/h1-4,7-14,16H,5-6,15,17H2,(H,29,31) |
| InChIKey | NRMPDYKPUPTZKX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|