C26H24F6N2O3S — CID 44530184
N-[3-(3-methylphenyl)propyl]-2-[3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]sulfonylanilino]acetamide (PubChem CID 44530184) has the molecular formula C26H24F6N2O3S and a molecular weight of 558.54 g/mol. Its IUPAC name is N-[3-(3-methylphenyl)propyl]-2-[3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]sulfonylanilino]acetamide.
| Compound Name | N-[3-(3-methylphenyl)propyl]-2-[3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]sulfonylanilino]acetamide |
|---|---|
| PubChem CID | 44530184 |
| Molecular Formula | C26H24F6N2O3S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | N-[3-(3-methylphenyl)propyl]-2-[3-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]sulfonylanilino]acetamide |
| SMILES | Cc1cccc(CCCNC(=O)CN(c2cccc(C(F)(F)F)c2)S(=O)(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H24F6N2O3S/c1-18-5-2-6-19(15-18)7-4-14-33-24(35)17-34(22-9-3-8-21(16-22)26(30,31)32)38(36,37)23-12-10-20(11-13-23)25(27,28)29/h2-3,5-6,8-13,15-16H,4,7,14,17H2,1H3,(H,33,35) |
| InChIKey | PUXRVCQETDUQOP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|