C28H31F3N2O6S — CID 43901277
2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(4-ethoxyphenyl)propyl]acetamide (PubChem CID 43901277) has the molecular formula C28H31F3N2O6S and a molecular weight of 580.63 g/mol. Its IUPAC name is 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(4-ethoxyphenyl)propyl]acetamide.
| Compound Name | 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(4-ethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43901277 |
| Molecular Formula | C28H31F3N2O6S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(4-ethoxyphenyl)propyl]acetamide |
| SMILES | CCOc1ccc(CCCNC(=O)CN(c2cccc(C(F)(F)F)c2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H31F3N2O6S/c1-4-39-23-12-10-20(11-13-23)7-6-16-32-27(34)19-33(22-9-5-8-21(17-22)28(29,30)31)40(35,36)24-14-15-25(37-2)26(18-24)38-3/h5,8-15,17-18H,4,6-7,16,19H2,1-3H3,(H,32,34) |
| InChIKey | XRDXHDMHVZWYMG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|