C27H28ClF3N2O5S2 — CID 43901241
N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 43901241) has the molecular formula C27H28ClF3N2O5S2 and a molecular weight of 617.11 g/mol. Its IUPAC name is N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 43901241 |
| Molecular Formula | C27H28ClF3N2O5S2 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2cccc(Cl)c2)c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C27H28ClF3N2O5S2/c1-37-24-11-10-23(16-25(24)38-2)40(35,36)33(22-9-4-7-20(15-22)27(29,30)31)17-26(34)32-12-5-13-39-18-19-6-3-8-21(28)14-19/h3-4,6-11,14-16H,5,12-13,17-18H2,1-2H3,(H,32,34) |
| InChIKey | BOEXDJKXGNBNAK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|