C29H36N2O5S2 — CID 43896698
2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43896698) has the molecular formula C29H36N2O5S2 and a molecular weight of 556.75 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43896698 |
| Molecular Formula | C29H36N2O5S2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2cccc(C)c2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C29H36N2O5S2/c1-21-8-6-9-24(15-21)20-37-13-7-12-30-29(32)19-31(25-16-22(2)14-23(3)17-25)38(33,34)26-10-11-27(35-4)28(18-26)36-5/h6,8-11,14-18H,7,12-13,19-20H2,1-5H3,(H,30,32) |
| InChIKey | FGAYBTIPJXYECW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|