C28H34N2O7S2 — CID 126177944
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126177944) has the molecular formula C28H34N2O7S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126177944 |
| Molecular Formula | C28H34N2O7S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCSCc2cccc(C)c2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H34N2O7S2/c1-20-7-6-8-21(15-20)19-38-14-13-29-28(31)18-30(24-16-22(34-2)9-11-25(24)35-3)39(32,33)23-10-12-26(36-4)27(17-23)37-5/h6-12,15-17H,13-14,18-19H2,1-5H3,(H,29,31) |
| InChIKey | CEZFDJPHLLHXCO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|