C27H32N2O7S2 — CID 126191223
N-(2-benzylsulfanylethyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide (PubChem CID 126191223) has the molecular formula C27H32N2O7S2 and a molecular weight of 560.69 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126191223 |
| Molecular Formula | C27H32N2O7S2 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCSCc2ccccc2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C27H32N2O7S2/c1-33-21-10-12-24(34-2)23(16-21)29(38(31,32)22-11-13-25(35-3)26(17-22)36-4)18-27(30)28-14-15-37-19-20-8-6-5-7-9-20/h5-13,16-17H,14-15,18-19H2,1-4H3,(H,28,30) |
| InChIKey | ZLWVRWZJUQTKHG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|