C28H33ClN2O7S2 — CID 43898277
N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide (PubChem CID 43898277) has the molecular formula C28H33ClN2O7S2 and a molecular weight of 609.17 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 43898277 |
| Molecular Formula | C28H33ClN2O7S2 |
| Molecular Weight | 609.17 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCCSCc2ccccc2Cl)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H33ClN2O7S2/c1-35-21-10-12-25(36-2)24(16-21)31(40(33,34)22-11-13-26(37-3)27(17-22)38-4)18-28(32)30-14-7-15-39-19-20-8-5-6-9-23(20)29/h5-6,8-13,16-17H,7,14-15,18-19H2,1-4H3,(H,30,32) |
| InChIKey | LBAMQRZHYWAROL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.17 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|