C27H31ClN2O6S2 — CID 126031798
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126031798) has the molecular formula C27H31ClN2O6S2 and a molecular weight of 579.14 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126031798 |
| Molecular Formula | C27H31ClN2O6S2 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCSCc2ccccc2Cl)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H31ClN2O6S2/c1-4-36-22-11-9-21(10-12-22)30(38(32,33)23-13-14-25(34-2)26(17-23)35-3)18-27(31)29-15-16-37-19-20-7-5-6-8-24(20)28/h5-14,17H,4,15-16,18-19H2,1-3H3,(H,29,31) |
| InChIKey | ODCUSAXIRQYBGU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|