C33H34ClN3O9S — CID 126118158
N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide (PubChem CID 126118158) has the molecular formula C33H34ClN3O9S and a molecular weight of 684.17 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126118158 |
| Molecular Formula | C33H34ClN3O9S |
| Molecular Weight | 684.17 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2ccc(OCc3ccccc3Cl)c(OC)c2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C33H34ClN3O9S/c1-41-24-11-14-28(42-2)27(17-24)37(47(39,40)25-12-15-29(43-3)32(18-25)45-5)20-33(38)36-35-19-22-10-13-30(31(16-22)44-4)46-21-23-8-6-7-9-26(23)34/h6-19H,20-21H2,1-5H3,(H,36,38)/b35-19- |
| InChIKey | CPCKWKMBCIVPOI-KMUKQRDJSA-N |
| XLogP | 5.31 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.17 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|