C21H25F3N2O6S — CID 30257511
2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(3-methoxypropyl)acetamide (PubChem CID 30257511) has the molecular formula C21H25F3N2O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 30257511 |
| Molecular Formula | C21H25F3N2O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[N-(3,4-dimethoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25F3N2O6S/c1-30-11-5-10-25-20(27)14-26(16-7-4-6-15(12-16)21(22,23)24)33(28,29)17-8-9-18(31-2)19(13-17)32-3/h4,6-9,12-13H,5,10-11,14H2,1-3H3,(H,25,27) |
| InChIKey | IASCRHZWIFGRGH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|