C20H23F3N2O5S — CID 3957853
N-(3-hydroxypropyl)-2-[N-(2-methoxy-5-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 3957853) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-[N-(2-methoxy-5-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(3-hydroxypropyl)-2-[N-(2-methoxy-5-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 3957853 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(3-hydroxypropyl)-2-[N-(2-methoxy-5-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)NCCCO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O5S/c1-14-7-8-17(30-2)18(11-14)31(28,29)25(13-19(27)24-9-4-10-26)16-6-3-5-15(12-16)20(21,22)23/h3,5-8,11-12,26H,4,9-10,13H2,1-2H3,(H,24,27) |
| InChIKey | VIZPLSWXQVQNLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|