C26H31N3O7S2 — CID 100797142
2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100797142) has the molecular formula C26H31N3O7S2 and a molecular weight of 561.68 g/mol. Its IUPAC name is 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100797142 |
| Molecular Formula | C26H31N3O7S2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | COc1cccc(N(CC(=O)NCCNS(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C26H31N3O7S2/c1-19-8-11-23(12-9-19)37(31,32)28-15-14-27-26(30)18-29(21-6-5-7-22(17-21)35-3)38(33,34)25-16-20(2)10-13-24(25)36-4/h5-13,16-17,28H,14-15,18H2,1-4H3,(H,27,30) |
| InChIKey | RXTAGPZEYPPDNO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|