C26H31N3O6S2 — CID 100795494
2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100795494) has the molecular formula C26H31N3O6S2 and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100795494 |
| Molecular Formula | C26H31N3O6S2 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)NCCNS(=O)(=O)c1ccc(C)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H31N3O6S2/c1-20-9-12-23(13-10-20)36(31,32)28-16-15-27-26(30)19-29(18-22-7-5-4-6-8-22)37(33,34)25-17-21(2)11-14-24(25)35-3/h4-14,17,28H,15-16,18-19H2,1-3H3,(H,27,30) |
| InChIKey | XKNSNWOIINLVNT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|