C27H33N3O7S2 — CID 100797192
2-(4-ethoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100797192) has the molecular formula C27H33N3O7S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(4-ethoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100797192 |
| Molecular Formula | C27H33N3O7S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-(4-ethoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCNS(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C27H33N3O7S2/c1-5-37-23-11-9-22(10-12-23)30(39(34,35)26-18-21(3)8-15-25(26)36-4)19-27(31)28-16-17-29-38(32,33)24-13-6-20(2)7-14-24/h6-15,18,29H,5,16-17,19H2,1-4H3,(H,28,31) |
| InChIKey | GTRDEESXJHXESN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|