C23H21F3N2O5S — CID 28548144
2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 28548144) has the molecular formula C23H21F3N2O5S and a molecular weight of 494.49 g/mol. Its IUPAC name is 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 28548144 |
| Molecular Formula | C23H21F3N2O5S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-(3-methoxy-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1cccc(N(CC(=O)Nc2ccc(F)c(F)c2F)S(=O)(=O)c2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C23H21F3N2O5S/c1-14-7-10-19(33-3)20(11-14)34(30,31)28(15-5-4-6-16(12-15)32-2)13-21(29)27-18-9-8-17(24)22(25)23(18)26/h4-12H,13H2,1-3H3,(H,27,29) |
| InChIKey | ZMMXBEVIRKNVCN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|