C19H21F3N2O5S — CID 32941616
2-[(2,5-dimethoxyphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 32941616) has the molecular formula C19H21F3N2O5S and a molecular weight of 446.45 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 32941616 |
| Molecular Formula | C19H21F3N2O5S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H21F3N2O5S/c1-4-9-24(11-17(25)23-14-7-6-13(20)18(21)19(14)22)30(26,27)16-10-12(28-2)5-8-15(16)29-3/h5-8,10H,4,9,11H2,1-3H3,(H,23,25) |
| InChIKey | SRAHXQAIQRCEAF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|