C17H17F3N2O5S2 — CID 31070445
methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylsulfamoyl]thiophene-2-carboxylate (PubChem CID 31070445) has the molecular formula C17H17F3N2O5S2 and a molecular weight of 450.46 g/mol. Its IUPAC name is methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31070445 |
| Molecular Formula | C17H17F3N2O5S2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylsulfamoyl]thiophene-2-carboxylate |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)S(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C17H17F3N2O5S2/c1-3-7-22(29(25,26)12-6-8-28-16(12)17(24)27-2)9-13(23)21-11-5-4-10(18)14(19)15(11)20/h4-6,8H,3,7,9H2,1-2H3,(H,21,23) |
| InChIKey | QCQXCWKKJKMIHG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|