C14H11F3N2O5S2 — CID 18148291
methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 18148291) has the molecular formula C14H11F3N2O5S2 and a molecular weight of 408.38 g/mol. Its IUPAC name is methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18148291 |
| Molecular Formula | C14H11F3N2O5S2 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | methyl 3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H11F3N2O5S2/c1-24-14(21)13-9(4-5-25-13)26(22,23)18-6-10(20)19-8-3-2-7(15)11(16)12(8)17/h2-5,18H,6H2,1H3,(H,19,20) |
| InChIKey | KQBIXFDGPZSROV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|