C8H12N2O4S2 — CID 43603472
methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate (PubChem CID 43603472) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43603472 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCCN |
| InChI | InChI=1S/C8H12N2O4S2/c1-14-8(11)7-6(2-5-15-7)16(12,13)10-4-3-9/h2,5,10H,3-4,9H2,1H3 |
| InChIKey | XXFKBZKPOJZWOH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |