methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate

C8H12N2O4S2 — CID 43603472

IUPACmethyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1S(=O)(=O)NCCN
InChIInChI=1S/C8H12N2O4S2/c1-14-8(11)7-6(2-5-15-7)16(12,13)10-4-3-9/h2,5,10H,3-4,9H2,1H3
InChIKeyXXFKBZKPOJZWOH-UHFFFAOYSA-N
MW264.33 g/mol
LogP-0.23
Rot. Bonds5

About methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate

methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate (PubChem CID 43603472) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate
PubChem CID43603472
Molecular FormulaC8H12N2O4S2
Molecular Weight264.33 g/mol
Exact Mass264.02
IUPAC Namemethyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1S(=O)(=O)NCCN
InChIInChI=1S/C8H12N2O4S2/c1-14-8(11)7-6(2-5-15-7)16(12,13)10-4-3-9/h2,5,10H,3-4,9H2,1H3
InChIKeyXXFKBZKPOJZWOH-UHFFFAOYSA-N
XLogP-0.23
TPSA98.49 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.33
LogP ≤ 5-0.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate?
The IUPAC name of methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate (CID 43603472) is methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate is COC(=O)c1sccc1S(=O)(=O)NCCN.
What is the InChIKey of methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate?
The InChIKey is XXFKBZKPOJZWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S2/c1-14-8(11)7-6(2-5-15-7)16(12,13)10-4-3-9/h2,5,10H,3-4,9H2,1H3.
What are the key properties of methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate?
methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate has a molecular weight of 264.33 g/mol, XLogP of -0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-aminoethylsulfamoyl)thiophene-2-carboxylate is sourced from PubChem (CID 43603472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).