C9H11NO7S2 — CID 66166894
2-hydroxy-3-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]propanoic acid (PubChem CID 66166894) has the molecular formula C9H11NO7S2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]propanoic acid.
| Compound Name | 2-hydroxy-3-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 66166894 |
| Molecular Formula | C9H11NO7S2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-hydroxy-3-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]propanoic acid |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C9H11NO7S2/c1-17-9(14)7-6(2-3-18-7)19(15,16)10-4-5(11)8(12)13/h2-3,5,10-11H,4H2,1H3,(H,12,13) |
| InChIKey | HHCSXLXHQVLQKC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |