C11H15NO6S2 — CID 43631169
2-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]pentanoic acid (PubChem CID 43631169) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 43631169 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-[(2-methoxycarbonylthiophen-3-yl)sulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)c1ccsc1C(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H15NO6S2/c1-3-4-7(10(13)14)12-20(16,17)8-5-6-19-9(8)11(15)18-2/h5-7,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | KZVKRLLKOHSKPX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |