C11H15NO6S2 — CID 71892320
methyl 3-(2-ethoxypropanoylsulfamoyl)thiophene-2-carboxylate (PubChem CID 71892320) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl 3-(2-ethoxypropanoylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2-ethoxypropanoylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71892320 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | methyl 3-(2-ethoxypropanoylsulfamoyl)thiophene-2-carboxylate |
| SMILES | CCOC(C)C(=O)NS(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C11H15NO6S2/c1-4-18-7(2)10(13)12-20(15,16)8-5-6-19-9(8)11(14)17-3/h5-7H,4H2,1-3H3,(H,12,13) |
| InChIKey | CXPWRXDHNGKCRD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |