C9H8N2O4S3 — CID 25044512
methyl 3-(1,3-thiazol-2-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 25044512) has the molecular formula C9H8N2O4S3 and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 3-(1,3-thiazol-2-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(1,3-thiazol-2-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25044512 |
| Molecular Formula | C9H8N2O4S3 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | methyl 3-(1,3-thiazol-2-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H8N2O4S3/c1-15-8(12)7-6(2-4-16-7)18(13,14)11-9-10-3-5-17-9/h2-5H,1H3,(H,10,11) |
| InChIKey | SZWYHTJLFXZZCJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |