C11H10N2O5S2 — CID 102694633
3-methoxy-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (PubChem CID 102694633) has the molecular formula C11H10N2O5S2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-methoxy-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 3-methoxy-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102694633 |
| Molecular Formula | C11H10N2O5S2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3-methoxy-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C11H10N2O5S2/c1-18-8-6-7(10(14)15)2-3-9(8)20(16,17)13-11-12-4-5-19-11/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | PUUJEDLYJFJIJH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |