C9H8N4O5S2 — CID 102695581
3-methoxy-4-(thiatriazol-5-ylsulfamoyl)benzoic acid (PubChem CID 102695581) has the molecular formula C9H8N4O5S2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-methoxy-4-(thiatriazol-5-ylsulfamoyl)benzoic acid.
| Compound Name | 3-methoxy-4-(thiatriazol-5-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102695581 |
| Molecular Formula | C9H8N4O5S2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 3-methoxy-4-(thiatriazol-5-ylsulfamoyl)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H8N4O5S2/c1-18-6-4-5(8(14)15)2-3-7(6)20(16,17)11-9-10-12-13-19-9/h2-4H,1H3,(H,14,15)(H,10,11,13) |
| InChIKey | MNPJOCIVSVDFGG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |