C8H6N4O4S2 — CID 114911956
4-(thiatriazol-5-ylsulfamoyl)benzoic acid (PubChem CID 114911956) has the molecular formula C8H6N4O4S2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-(thiatriazol-5-ylsulfamoyl)benzoic acid.
| Compound Name | 4-(thiatriazol-5-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114911956 |
| Molecular Formula | C8H6N4O4S2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4-(thiatriazol-5-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2nnns2)cc1 |
| InChI | InChI=1S/C8H6N4O4S2/c13-7(14)5-1-3-6(4-2-5)18(15,16)10-8-9-11-12-17-8/h1-4H,(H,13,14)(H,9,10,12) |
| InChIKey | VLLPAPPEUFVONV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |