C10H10N4O4S2 — CID 114911938
4-ethyl-3-(thiatriazol-5-ylsulfamoyl)benzoic acid (PubChem CID 114911938) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-ethyl-3-(thiatriazol-5-ylsulfamoyl)benzoic acid.
| Compound Name | 4-ethyl-3-(thiatriazol-5-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114911938 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-ethyl-3-(thiatriazol-5-ylsulfamoyl)benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C10H10N4O4S2/c1-2-6-3-4-7(9(15)16)5-8(6)20(17,18)12-10-11-13-14-19-10/h3-5H,2H2,1H3,(H,15,16)(H,11,12,14) |
| InChIKey | DGDGLKLWMJBLCH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |