C9H9N5O2S3 — CID 106998596
3-methyl-4-(thiatriazol-5-ylsulfamoyl)benzenecarbothioamide (PubChem CID 106998596) has the molecular formula C9H9N5O2S3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-methyl-4-(thiatriazol-5-ylsulfamoyl)benzenecarbothioamide.
| Compound Name | 3-methyl-4-(thiatriazol-5-ylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106998596 |
| Molecular Formula | C9H9N5O2S3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 3-methyl-4-(thiatriazol-5-ylsulfamoyl)benzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H9N5O2S3/c1-5-4-6(8(10)17)2-3-7(5)19(15,16)12-9-11-13-14-18-9/h2-4H,1H3,(H2,10,17)(H,11,12,14) |
| InChIKey | PJNRUKCQQDNYCX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|