C7H6FN5O2S2 — CID 114911741
4-amino-2-fluoro-N-(thiatriazol-5-yl)benzenesulfonamide (PubChem CID 114911741) has the molecular formula C7H6FN5O2S2 and a molecular weight of 275.29 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-(thiatriazol-5-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-fluoro-N-(thiatriazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114911741 |
| Molecular Formula | C7H6FN5O2S2 |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 4-amino-2-fluoro-N-(thiatriazol-5-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nnns2)c(F)c1 |
| InChI | InChI=1S/C7H6FN5O2S2/c8-5-3-4(9)1-2-6(5)17(14,15)11-7-10-12-13-16-7/h1-3H,9H2,(H,10,11,13) |
| InChIKey | PJDYJPHMKHLXRB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|