C7H5Cl2N5O2S2 — CID 114911751
3-amino-2,4-dichloro-N-(thiatriazol-5-yl)benzenesulfonamide (PubChem CID 114911751) has the molecular formula C7H5Cl2N5O2S2 and a molecular weight of 326.19 g/mol. Its IUPAC name is 3-amino-2,4-dichloro-N-(thiatriazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-dichloro-N-(thiatriazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114911751 |
| Molecular Formula | C7H5Cl2N5O2S2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | 3-amino-2,4-dichloro-N-(thiatriazol-5-yl)benzenesulfonamide |
| SMILES | Nc1c(Cl)ccc(S(=O)(=O)Nc2nnns2)c1Cl |
| InChI | InChI=1S/C7H5Cl2N5O2S2/c8-3-1-2-4(5(9)6(3)10)18(15,16)12-7-11-13-14-17-7/h1-2H,10H2,(H,11,12,14) |
| InChIKey | FDANFPIQBIQRET-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|