C8H9ClN6O2S2 — CID 114914138
5-chloro-6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-3-sulfonamide (PubChem CID 114914138) has the molecular formula C8H9ClN6O2S2 and a molecular weight of 320.79 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114914138 |
| Molecular Formula | C8H9ClN6O2S2 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 5-chloro-6-(ethylamino)-N-(thiatriazol-5-yl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2nnns2)cc1Cl |
| InChI | InChI=1S/C8H9ClN6O2S2/c1-2-10-7-6(9)3-5(4-11-7)19(16,17)13-8-12-14-15-18-8/h3-4H,2H2,1H3,(H,10,11)(H,12,13,15) |
| InChIKey | KGHZLAIUBZVMEC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |