C11H14ClN5O2S — CID 64607000
5-chloro-6-(ethylamino)-N-(1-methylpyrazol-4-yl)pyridine-3-sulfonamide (PubChem CID 64607000) has the molecular formula C11H14ClN5O2S and a molecular weight of 315.79 g/mol. Its IUPAC name is 5-chloro-6-(ethylamino)-N-(1-methylpyrazol-4-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(ethylamino)-N-(1-methylpyrazol-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607000 |
| Molecular Formula | C11H14ClN5O2S |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-chloro-6-(ethylamino)-N-(1-methylpyrazol-4-yl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2cnn(C)c2)cc1Cl |
| InChI | InChI=1S/C11H14ClN5O2S/c1-3-13-11-10(12)4-9(6-14-11)20(18,19)16-8-5-15-17(2)7-8/h4-7,16H,3H2,1-2H3,(H,13,14) |
| InChIKey | YPSPXBNDERZRNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |