C10H14N6O2S — CID 62146781
2-(ethylamino)-N-(1-methylpyrazol-4-yl)pyrimidine-5-sulfonamide (PubChem CID 62146781) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1-methylpyrazol-4-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(1-methylpyrazol-4-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62146781 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(ethylamino)-N-(1-methylpyrazol-4-yl)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2cnn(C)c2)cn1 |
| InChI | InChI=1S/C10H14N6O2S/c1-3-11-10-12-5-9(6-13-10)19(17,18)15-8-4-14-16(2)7-8/h4-7,15H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | WXOQTSXKQITBLX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |